C17H12F4O4 — CID 19588274
1,3-bis[3-(difluoromethoxy)phenyl]propane-1,3-dione (PubChem CID 19588274) has the molecular formula C17H12F4O4 and a molecular weight of 356.27 g/mol. Its IUPAC name is 1,3-bis[3-(difluoromethoxy)phenyl]propane-1,3-dione.
| Compound Name | 1,3-bis[3-(difluoromethoxy)phenyl]propane-1,3-dione |
|---|---|
| PubChem CID | 19588274 |
| Molecular Formula | C17H12F4O4 |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 1,3-bis[3-(difluoromethoxy)phenyl]propane-1,3-dione |
| SMILES | O=C(CC(=O)c1cccc(OC(F)F)c1)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C17H12F4O4/c18-16(19)24-12-5-1-3-10(7-12)14(22)9-15(23)11-4-2-6-13(8-11)25-17(20)21/h1-8,16-17H,9H2 |
| InChIKey | AJRXXBHEZIHUQS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|