C12H11F5O2 — CID 115792223
1-[3-(difluoromethoxy)phenyl]-5,5,5-trifluoropentan-1-one (PubChem CID 115792223) has the molecular formula C12H11F5O2 and a molecular weight of 282.21 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)phenyl]-5,5,5-trifluoropentan-1-one.
| Compound Name | 1-[3-(difluoromethoxy)phenyl]-5,5,5-trifluoropentan-1-one |
|---|---|
| PubChem CID | 115792223 |
| Molecular Formula | C12H11F5O2 |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 1-[3-(difluoromethoxy)phenyl]-5,5,5-trifluoropentan-1-one |
| SMILES | O=C(CCCC(F)(F)F)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C12H11F5O2/c13-11(14)19-9-4-1-3-8(7-9)10(18)5-2-6-12(15,16)17/h1,3-4,7,11H,2,5-6H2 |
| InChIKey | IJBONSYFVXAWQQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |