C10H8F3IO — CID 114976562
4,4,4-trifluoro-1-(3-iodophenyl)butan-1-one (PubChem CID 114976562) has the molecular formula C10H8F3IO and a molecular weight of 328.07 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-(3-iodophenyl)butan-1-one.
| Compound Name | 4,4,4-trifluoro-1-(3-iodophenyl)butan-1-one |
|---|---|
| PubChem CID | 114976562 |
| Molecular Formula | C10H8F3IO |
| Molecular Weight | 328.07 g/mol |
| Exact Mass | 327.96 |
| IUPAC Name | 4,4,4-trifluoro-1-(3-iodophenyl)butan-1-one |
| SMILES | O=C(CCC(F)(F)F)c1cccc(I)c1 |
| InChI | InChI=1S/C10H8F3IO/c11-10(12,13)5-4-9(15)7-2-1-3-8(14)6-7/h1-3,6H,4-5H2 |
| InChIKey | RHURPLMGOJPRJH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.07 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|