C12H9F3N2O — CID 64567570
4,4,4-trifluoro-1-quinoxalin-6-ylbutan-1-one (PubChem CID 64567570) has the molecular formula C12H9F3N2O and a molecular weight of 254.21 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-quinoxalin-6-ylbutan-1-one.
| Compound Name | 4,4,4-trifluoro-1-quinoxalin-6-ylbutan-1-one |
|---|---|
| PubChem CID | 64567570 |
| Molecular Formula | C12H9F3N2O |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 4,4,4-trifluoro-1-quinoxalin-6-ylbutan-1-one |
| SMILES | O=C(CCC(F)(F)F)c1ccc2nccnc2c1 |
| InChI | InChI=1S/C12H9F3N2O/c13-12(14,15)4-3-11(18)8-1-2-9-10(7-8)17-6-5-16-9/h1-2,5-7H,3-4H2 |
| InChIKey | OWQPISSPWMWONP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |