C12H12F3NO — CID 116612061
1-(2,3-dihydro-1H-indol-6-yl)-4,4,4-trifluorobutan-1-one (PubChem CID 116612061) has the molecular formula C12H12F3NO and a molecular weight of 243.23 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-indol-6-yl)-4,4,4-trifluorobutan-1-one.
| Compound Name | 1-(2,3-dihydro-1H-indol-6-yl)-4,4,4-trifluorobutan-1-one |
|---|---|
| PubChem CID | 116612061 |
| Molecular Formula | C12H12F3NO |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 1-(2,3-dihydro-1H-indol-6-yl)-4,4,4-trifluorobutan-1-one |
| SMILES | O=C(CCC(F)(F)F)c1ccc2c(c1)NCC2 |
| InChI | InChI=1S/C12H12F3NO/c13-12(14,15)5-3-11(17)9-2-1-8-4-6-16-10(8)7-9/h1-2,7,16H,3-6H2 |
| InChIKey | QPEPBDSTWCIARN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |