C13H12N2OS — CID 116611918
1-(2,3-dihydro-1H-indol-6-yl)-2-(1,3-thiazol-2-yl)ethanone (PubChem CID 116611918) has the molecular formula C13H12N2OS and a molecular weight of 244.32 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-indol-6-yl)-2-(1,3-thiazol-2-yl)ethanone.
| Compound Name | 1-(2,3-dihydro-1H-indol-6-yl)-2-(1,3-thiazol-2-yl)ethanone |
|---|---|
| PubChem CID | 116611918 |
| Molecular Formula | C13H12N2OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 1-(2,3-dihydro-1H-indol-6-yl)-2-(1,3-thiazol-2-yl)ethanone |
| SMILES | O=C(Cc1nccs1)c1ccc2c(c1)NCC2 |
| InChI | InChI=1S/C13H12N2OS/c16-12(8-13-15-5-6-17-13)10-2-1-9-3-4-14-11(9)7-10/h1-2,5-7,14H,3-4,8H2 |
| InChIKey | HXPQVZHNWXOBNR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |