C16H13BrFNO — CID 116611894
2-(2-bromo-4-fluorophenyl)-1-(2,3-dihydro-1H-indol-6-yl)ethanone (PubChem CID 116611894) has the molecular formula C16H13BrFNO and a molecular weight of 334.19 g/mol. Its IUPAC name is 2-(2-bromo-4-fluorophenyl)-1-(2,3-dihydro-1H-indol-6-yl)ethanone.
| Compound Name | 2-(2-bromo-4-fluorophenyl)-1-(2,3-dihydro-1H-indol-6-yl)ethanone |
|---|---|
| PubChem CID | 116611894 |
| Molecular Formula | C16H13BrFNO |
| Molecular Weight | 334.19 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 2-(2-bromo-4-fluorophenyl)-1-(2,3-dihydro-1H-indol-6-yl)ethanone |
| SMILES | O=C(Cc1ccc(F)cc1Br)c1ccc2c(c1)NCC2 |
| InChI | InChI=1S/C16H13BrFNO/c17-14-9-13(18)4-3-11(14)8-16(20)12-2-1-10-5-6-19-15(10)7-12/h1-4,7,9,19H,5-6,8H2 |
| InChIKey | RQLSFZNIJBXYFB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.19 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |