C12H14ClNO2 — CID 66972289
prop-2-enyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride (PubChem CID 66972289) has the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. Its IUPAC name is prop-2-enyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride.
| Compound Name | prop-2-enyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 66972289 |
| Molecular Formula | C12H14ClNO2 |
| Molecular Weight | 239.70 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | prop-2-enyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride |
| SMILES | C=CCOC(=O)c1ccc2c(c1)NCC2.Cl |
| InChI | InChI=1S/C12H13NO2.ClH/c1-2-7-15-12(14)10-4-3-9-5-6-13-11(9)8-10;/h2-4,8,13H,1,5-7H2;1H |
| InChIKey | JWYIVRDFMCNDBT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.70 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|