1-ethoxypropan-2-yl 2,3-dihydro-1H-indole-6-carboxylate

C14H19NO3 — CID 103489060

IUPAC1-ethoxypropan-2-yl 2,3-dihydro-1H-indole-6-carboxylate
SMILESCCOCC(C)OC(=O)c1ccc2c(c1)NCC2
InChIInChI=1S/C14H19NO3/c1-3-17-9-10(2)18-14(16)12-5-4-11-6-7-15-13(11)8-12/h4-5,8,10,15H,3,6-7,9H2,1-2H3
InChIKeySYZWBIOMDVYUDR-UHFFFAOYSA-N
MW249.31 g/mol
LogP2.24
Rot. Bonds5

About 1-ethoxypropan-2-yl 2,3-dihydro-1H-indole-6-carboxylate

1-ethoxypropan-2-yl 2,3-dihydro-1H-indole-6-carboxylate (PubChem CID 103489060) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 1-ethoxypropan-2-yl 2,3-dihydro-1H-indole-6-carboxylate.

Molecular Properties

Compound Name1-ethoxypropan-2-yl 2,3-dihydro-1H-indole-6-carboxylate
PubChem CID103489060
Molecular FormulaC14H19NO3
Molecular Weight249.31 g/mol
Exact Mass249.14
IUPAC Name1-ethoxypropan-2-yl 2,3-dihydro-1H-indole-6-carboxylate
SMILESCCOCC(C)OC(=O)c1ccc2c(c1)NCC2
InChIInChI=1S/C14H19NO3/c1-3-17-9-10(2)18-14(16)12-5-4-11-6-7-15-13(11)8-12/h4-5,8,10,15H,3,6-7,9H2,1-2H3
InChIKeySYZWBIOMDVYUDR-UHFFFAOYSA-N
XLogP2.24
TPSA47.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.31
LogP ≤ 52.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-ethoxypropan-2-yl 2,3-dihydro-1H-indole-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-ethoxypropan-2-yl 2,3-dihydro-1H-indole-6-carboxylate?
The IUPAC name of 1-ethoxypropan-2-yl 2,3-dihydro-1H-indole-6-carboxylate (CID 103489060) is 1-ethoxypropan-2-yl 2,3-dihydro-1H-indole-6-carboxylate.
What is the SMILES notation for 1-ethoxypropan-2-yl 2,3-dihydro-1H-indole-6-carboxylate?
The canonical SMILES for 1-ethoxypropan-2-yl 2,3-dihydro-1H-indole-6-carboxylate is CCOCC(C)OC(=O)c1ccc2c(c1)NCC2.
What is the InChIKey of 1-ethoxypropan-2-yl 2,3-dihydro-1H-indole-6-carboxylate?
The InChIKey is SYZWBIOMDVYUDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3/c1-3-17-9-10(2)18-14(16)12-5-4-11-6-7-15-13(11)8-12/h4-5,8,10,15H,3,6-7,9H2,1-2H3.
What are the key properties of 1-ethoxypropan-2-yl 2,3-dihydro-1H-indole-6-carboxylate?
1-ethoxypropan-2-yl 2,3-dihydro-1H-indole-6-carboxylate has a molecular weight of 249.31 g/mol, XLogP of 2.24, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxypropan-2-yl 2,3-dihydro-1H-indole-6-carboxylate is sourced from PubChem (CID 103489060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).