C14H18ClN3O3 — CID 162440782
piperazine-1-carbonyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride (PubChem CID 162440782) has the molecular formula C14H18ClN3O3 and a molecular weight of 311.77 g/mol. Its IUPAC name is piperazine-1-carbonyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride.
| Compound Name | piperazine-1-carbonyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 162440782 |
| Molecular Formula | C14H18ClN3O3 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | piperazine-1-carbonyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OC(=O)N1CCNCC1)c1ccc2c(c1)NCC2 |
| InChI | InChI=1S/C14H17N3O3.ClH/c18-13(20-14(19)17-7-5-15-6-8-17)11-2-1-10-3-4-16-12(10)9-11;/h1-2,9,15-16H,3-8H2;1H |
| InChIKey | HIEXNUCMXWDRTA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|