About piperazine-1-carbonyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride
piperazine-1-carbonyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride (PubChem CID 162440782) has the molecular formula C14H18ClN3O3
and a molecular weight of 311.77 g/mol. Its IUPAC name is piperazine-1-carbonyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | piperazine-1-carbonyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride |
| PubChem CID | 162440782 |
| Molecular Formula | C14H18ClN3O3 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | piperazine-1-carbonyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OC(=O)N1CCNCC1)c1ccc2c(c1)NCC2 |
| InChI | InChI=1S/C14H17N3O3.ClH/c18-13(20-14(19)17-7-5-15-6-8-17)11-2-1-10-3-4-16-12(10)9-11;/h1-2,9,15-16H,3-8H2;1H |
| InChIKey | HIEXNUCMXWDRTA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze piperazine-1-carbonyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine-1-carbonyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride?
The IUPAC name of piperazine-1-carbonyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride (CID 162440782) is piperazine-1-carbonyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride.
What is the SMILES notation for piperazine-1-carbonyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride?
The canonical SMILES for piperazine-1-carbonyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride is Cl.O=C(OC(=O)N1CCNCC1)c1ccc2c(c1)NCC2.
What is the InChIKey of piperazine-1-carbonyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride?
The InChIKey is HIEXNUCMXWDRTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O3.ClH/c18-13(20-14(19)17-7-5-15-6-8-17)11-2-1-10-3-4-16-12(10)9-11;/h1-2,9,15-16H,3-8H2;1H.
What are the key properties of piperazine-1-carbonyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride?
piperazine-1-carbonyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride has a molecular weight of 311.77 g/mol, XLogP of 1.26, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine-1-carbonyl 2,3-dihydro-1H-indole-6-carboxylate;hydrochloride is sourced from PubChem (CID 162440782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).