C25H17F3N2O — CID 176900316
(E)-3-quinoxalin-6-yl-1-[4-[4-(2,2,2-trifluoroethyl)phenyl]phenyl]prop-2-en-1-one (PubChem CID 176900316) has the molecular formula C25H17F3N2O and a molecular weight of 418.42 g/mol. Its IUPAC name is (E)-3-quinoxalin-6-yl-1-[4-[4-(2,2,2-trifluoroethyl)phenyl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-quinoxalin-6-yl-1-[4-[4-(2,2,2-trifluoroethyl)phenyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 176900316 |
| Molecular Formula | C25H17F3N2O |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | (E)-3-quinoxalin-6-yl-1-[4-[4-(2,2,2-trifluoroethyl)phenyl]phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc2nccnc2c1)c1ccc(-c2ccc(CC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C25H17F3N2O/c26-25(27,28)16-18-1-5-19(6-2-18)20-7-9-21(10-8-20)24(31)12-4-17-3-11-22-23(15-17)30-14-13-29-22/h1-15H,16H2/b12-4+ |
| InChIKey | ACAUBSROONPSCD-UUILKARUSA-N |
| XLogP | 6.30 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|