C15H10N2O2 — CID 44614580
(E)-3-(2,1,3-benzoxadiazol-5-yl)-1-phenylprop-2-en-1-one (PubChem CID 44614580) has the molecular formula C15H10N2O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is (E)-3-(2,1,3-benzoxadiazol-5-yl)-1-phenylprop-2-en-1-one.
| Compound Name | (E)-3-(2,1,3-benzoxadiazol-5-yl)-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 44614580 |
| Molecular Formula | C15H10N2O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | (E)-3-(2,1,3-benzoxadiazol-5-yl)-1-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc2nonc2c1)c1ccccc1 |
| InChI | InChI=1S/C15H10N2O2/c18-15(12-4-2-1-3-5-12)9-7-11-6-8-13-14(10-11)17-19-16-13/h1-10H/b9-7+ |
| InChIKey | JFYXPMOSASMFOH-VQHVLOKHSA-N |
| XLogP | 3.12 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|