C17H16O3 — CID 170661280
(E)-3-[3,4-bis(hydroxymethyl)phenyl]-1-phenylprop-2-en-1-one (PubChem CID 170661280) has the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. Its IUPAC name is (E)-3-[3,4-bis(hydroxymethyl)phenyl]-1-phenylprop-2-en-1-one.
| Compound Name | (E)-3-[3,4-bis(hydroxymethyl)phenyl]-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 170661280 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (E)-3-[3,4-bis(hydroxymethyl)phenyl]-1-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(CO)c(CO)c1)c1ccccc1 |
| InChI | InChI=1S/C17H16O3/c18-11-15-8-6-13(10-16(15)12-19)7-9-17(20)14-4-2-1-3-5-14/h1-10,18-19H,11-12H2/b9-7+ |
| InChIKey | BQGJXOWRWCPGLP-VQHVLOKHSA-N |
| XLogP | 2.57 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|