About 5-[(E)-2-(benzenesulfinyl)ethenyl]-2,1,3-benzoxadiazole
5-[(E)-2-(benzenesulfinyl)ethenyl]-2,1,3-benzoxadiazole (PubChem CID 44614578) has the molecular formula C14H10N2O2S
and a molecular weight of 270.31 g/mol. Its IUPAC name is 5-[(E)-2-(benzenesulfinyl)ethenyl]-2,1,3-benzoxadiazole.
Molecular Properties
| Compound Name | 5-[(E)-2-(benzenesulfinyl)ethenyl]-2,1,3-benzoxadiazole |
| PubChem CID | 44614578 |
| Molecular Formula | C14H10N2O2S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 5-[(E)-2-(benzenesulfinyl)ethenyl]-2,1,3-benzoxadiazole |
| SMILES | O=S(/C=C/c1ccc2nonc2c1)c1ccccc1 |
| InChI | InChI=1S/C14H10N2O2S/c17-19(12-4-2-1-3-5-12)9-8-11-6-7-13-14(10-11)16-18-15-13/h1-10H/b9-8+ |
| InChIKey | QUFFJINGFQVSGN-CMDGGOBGSA-N |
| XLogP | 3.00 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(E)-2-(benzenesulfinyl)ethenyl]-2,1,3-benzoxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-2-(benzenesulfinyl)ethenyl]-2,1,3-benzoxadiazole?
The IUPAC name of 5-[(E)-2-(benzenesulfinyl)ethenyl]-2,1,3-benzoxadiazole (CID 44614578) is 5-[(E)-2-(benzenesulfinyl)ethenyl]-2,1,3-benzoxadiazole.
What is the SMILES notation for 5-[(E)-2-(benzenesulfinyl)ethenyl]-2,1,3-benzoxadiazole?
The canonical SMILES for 5-[(E)-2-(benzenesulfinyl)ethenyl]-2,1,3-benzoxadiazole is O=S(/C=C/c1ccc2nonc2c1)c1ccccc1.
What is the InChIKey of 5-[(E)-2-(benzenesulfinyl)ethenyl]-2,1,3-benzoxadiazole?
The InChIKey is QUFFJINGFQVSGN-CMDGGOBGSA-N. The full InChI is InChI=1S/C14H10N2O2S/c17-19(12-4-2-1-3-5-12)9-8-11-6-7-13-14(10-11)16-18-15-13/h1-10H/b9-8+.
What are the key properties of 5-[(E)-2-(benzenesulfinyl)ethenyl]-2,1,3-benzoxadiazole?
5-[(E)-2-(benzenesulfinyl)ethenyl]-2,1,3-benzoxadiazole has a molecular weight of 270.31 g/mol, XLogP of 3.00, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-2-(benzenesulfinyl)ethenyl]-2,1,3-benzoxadiazole is sourced from PubChem (CID 44614578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).