C9H8N2O2S — CID 5325357
3-(benzenesulfinyl)-4-methyl-1,2,5-oxadiazole (PubChem CID 5325357) has the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. Its IUPAC name is 3-(benzenesulfinyl)-4-methyl-1,2,5-oxadiazole.
| Compound Name | 3-(benzenesulfinyl)-4-methyl-1,2,5-oxadiazole |
|---|---|
| PubChem CID | 5325357 |
| Molecular Formula | C9H8N2O2S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 3-(benzenesulfinyl)-4-methyl-1,2,5-oxadiazole |
| SMILES | Cc1nonc1S(=O)c1ccccc1 |
| InChI | InChI=1S/C9H8N2O2S/c1-7-9(11-13-10-7)14(12)8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | JLWFAYAKNPKPKH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |