C17H16N2OS — CID 11860311
3,5-dimethyl-1-phenyl-4-[(S)-phenylsulfinyl]pyrazole (PubChem CID 11860311) has the molecular formula C17H16N2OS and a molecular weight of 296.40 g/mol. Its IUPAC name is 3,5-dimethyl-1-phenyl-4-[(S)-phenylsulfinyl]pyrazole.
| Compound Name | 3,5-dimethyl-1-phenyl-4-[(S)-phenylsulfinyl]pyrazole |
|---|---|
| PubChem CID | 11860311 |
| Molecular Formula | C17H16N2OS |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 3,5-dimethyl-1-phenyl-4-[(S)-phenylsulfinyl]pyrazole |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1[S@@](=O)c1ccccc1 |
| InChI | InChI=1S/C17H16N2OS/c1-13-17(21(20)16-11-7-4-8-12-16)14(2)19(18-13)15-9-5-3-6-10-15/h3-12H,1-2H3/t21-/m0/s1 |
| InChIKey | QNISIXSGLJJTGP-NRFANRHFSA-N |
| XLogP | 3.66 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |