C17H17N3O2S — CID 972247
N-(3,5-dimethyl-1-phenylpyrazol-4-yl)benzenesulfonamide (PubChem CID 972247) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is N-(3,5-dimethyl-1-phenylpyrazol-4-yl)benzenesulfonamide.
| Compound Name | N-(3,5-dimethyl-1-phenylpyrazol-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 972247 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-(3,5-dimethyl-1-phenylpyrazol-4-yl)benzenesulfonamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H17N3O2S/c1-13-17(19-23(21,22)16-11-7-4-8-12-16)14(2)20(18-13)15-9-5-3-6-10-15/h3-12,19H,1-2H3 |
| InChIKey | KOZMWQBQHVMFDI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |