C18H19N3O2S — CID 25342658
N-[3,5-dimethyl-1-(4-methylphenyl)pyrazol-4-yl]benzenesulfonamide (PubChem CID 25342658) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is N-[3,5-dimethyl-1-(4-methylphenyl)pyrazol-4-yl]benzenesulfonamide.
| Compound Name | N-[3,5-dimethyl-1-(4-methylphenyl)pyrazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 25342658 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-[3,5-dimethyl-1-(4-methylphenyl)pyrazol-4-yl]benzenesulfonamide |
| SMILES | Cc1ccc(-n2nc(C)c(NS(=O)(=O)c3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C18H19N3O2S/c1-13-9-11-16(12-10-13)21-15(3)18(14(2)19-21)20-24(22,23)17-7-5-4-6-8-17/h4-12,20H,1-3H3 |
| InChIKey | KJPRGUNOVIBELD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |