C25H24N4O3S — CID 99164246
N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-[(4-methylphenyl)sulfamoyl]benzamide (PubChem CID 99164246) has the molecular formula C25H24N4O3S and a molecular weight of 460.56 g/mol. Its IUPAC name is N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-[(4-methylphenyl)sulfamoyl]benzamide.
| Compound Name | N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-[(4-methylphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 99164246 |
| Molecular Formula | C25H24N4O3S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-[(4-methylphenyl)sulfamoyl]benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cccc(C(=O)Nc3c(C)nn(-c4ccccc4)c3C)c2)cc1 |
| InChI | InChI=1S/C25H24N4O3S/c1-17-12-14-21(15-13-17)28-33(31,32)23-11-7-8-20(16-23)25(30)26-24-18(2)27-29(19(24)3)22-9-5-4-6-10-22/h4-16,28H,1-3H3,(H,26,30) |
| InChIKey | BIKCIPHXGVPNMY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |