C24H28N4O3S — CID 16575285
N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-(2-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 16575285) has the molecular formula C24H28N4O3S and a molecular weight of 452.58 g/mol. Its IUPAC name is N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-(2-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-(2-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 16575285 |
| Molecular Formula | C24H28N4O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-3-(2-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1NC(=O)c1cccc(S(=O)(=O)N2CCCCC2C)c1 |
| InChI | InChI=1S/C24H28N4O3S/c1-17-10-7-8-15-27(17)32(30,31)22-14-9-11-20(16-22)24(29)25-23-18(2)26-28(19(23)3)21-12-5-4-6-13-21/h4-6,9,11-14,16-17H,7-8,10,15H2,1-3H3,(H,25,29) |
| InChIKey | BXTJPKULYWLQMZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |