C18H20N4O4S2 — CID 22203263
3,5-dimethyl-N-[4-(methylsulfamoyl)phenyl]-1-phenylpyrazole-4-sulfonamide (PubChem CID 22203263) has the molecular formula C18H20N4O4S2 and a molecular weight of 420.52 g/mol. Its IUPAC name is 3,5-dimethyl-N-[4-(methylsulfamoyl)phenyl]-1-phenylpyrazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-N-[4-(methylsulfamoyl)phenyl]-1-phenylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 22203263 |
| Molecular Formula | C18H20N4O4S2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 3,5-dimethyl-N-[4-(methylsulfamoyl)phenyl]-1-phenylpyrazole-4-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NS(=O)(=O)c2c(C)nn(-c3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C18H20N4O4S2/c1-13-18(14(2)22(20-13)16-7-5-4-6-8-16)28(25,26)21-15-9-11-17(12-10-15)27(23,24)19-3/h4-12,19,21H,1-3H3 |
| InChIKey | DWAUGMIYKTXOOH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |