C17H16FN3O2S — CID 22773337
N-(4-fluorophenyl)-3,5-dimethyl-1-phenylpyrazole-4-sulfonamide (PubChem CID 22773337) has the molecular formula C17H16FN3O2S and a molecular weight of 345.40 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3,5-dimethyl-1-phenylpyrazole-4-sulfonamide.
| Compound Name | N-(4-fluorophenyl)-3,5-dimethyl-1-phenylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 22773337 |
| Molecular Formula | C17H16FN3O2S |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N-(4-fluorophenyl)-3,5-dimethyl-1-phenylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1S(=O)(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H16FN3O2S/c1-12-17(13(2)21(19-12)16-6-4-3-5-7-16)24(22,23)20-15-10-8-14(18)9-11-15/h3-11,20H,1-2H3 |
| InChIKey | BVXUYTLUPJZDIY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |