C18H18N4O4S — CID 22775075
3,5-dimethyl-N-(4-methyl-3-nitrophenyl)-1-phenylpyrazole-4-sulfonamide (PubChem CID 22775075) has the molecular formula C18H18N4O4S and a molecular weight of 386.43 g/mol. Its IUPAC name is 3,5-dimethyl-N-(4-methyl-3-nitrophenyl)-1-phenylpyrazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-N-(4-methyl-3-nitrophenyl)-1-phenylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 22775075 |
| Molecular Formula | C18H18N4O4S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 3,5-dimethyl-N-(4-methyl-3-nitrophenyl)-1-phenylpyrazole-4-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2c(C)nn(-c3ccccc3)c2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H18N4O4S/c1-12-9-10-15(11-17(12)22(23)24)20-27(25,26)18-13(2)19-21(14(18)3)16-7-5-4-6-8-16/h4-11,20H,1-3H3 |
| InChIKey | HLMGSHYKKNQJMJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|