C14H16N2 — CID 143867977
3,5-dimethyl-1-phenyl-4-[(Z)-prop-1-enyl]pyrazole (PubChem CID 143867977) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 3,5-dimethyl-1-phenyl-4-[(Z)-prop-1-enyl]pyrazole.
| Compound Name | 3,5-dimethyl-1-phenyl-4-[(Z)-prop-1-enyl]pyrazole |
|---|---|
| PubChem CID | 143867977 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 3,5-dimethyl-1-phenyl-4-[(Z)-prop-1-enyl]pyrazole |
| SMILES | C/C=C\c1c(C)nn(-c2ccccc2)c1C |
| InChI | InChI=1S/C14H16N2/c1-4-8-14-11(2)15-16(12(14)3)13-9-6-5-7-10-13/h4-10H,1-3H3/b8-4- |
| InChIKey | OMCUNVTUPSLQIJ-YWEYNIOJSA-N |
| XLogP | 3.52 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |