C18H22N4O2 — CID 9489262
(E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[2-(ethylamino)-2-oxoethyl]prop-2-enamide (PubChem CID 9489262) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[2-(ethylamino)-2-oxoethyl]prop-2-enamide.
| Compound Name | (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[2-(ethylamino)-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 9489262 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[2-(ethylamino)-2-oxoethyl]prop-2-enamide |
| SMILES | CCNC(=O)CNC(=O)/C=C/c1c(C)nn(-c2ccccc2)c1C |
| InChI | InChI=1S/C18H22N4O2/c1-4-19-18(24)12-20-17(23)11-10-16-13(2)21-22(14(16)3)15-8-6-5-7-9-15/h5-11H,4,12H2,1-3H3,(H,19,24)(H,20,23)/b11-10+ |
| InChIKey | BNMWIFWXCWZRCY-ZHACJKMWSA-N |
| XLogP | 1.75 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|