C21H20N4O2 — CID 10808475
(E,2Z)-4-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-(phenylhydrazinylidene)but-3-enoic acid (PubChem CID 10808475) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is (E,2Z)-4-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-(phenylhydrazinylidene)but-3-enoic acid.
| Compound Name | (E,2Z)-4-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-(phenylhydrazinylidene)but-3-enoic acid |
|---|---|
| PubChem CID | 10808475 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (E,2Z)-4-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-(phenylhydrazinylidene)but-3-enoic acid |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=C/C(=N/Nc1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H20N4O2/c1-15-19(16(2)25(24-15)18-11-7-4-8-12-18)13-14-20(21(26)27)23-22-17-9-5-3-6-10-17/h3-14,22H,1-2H3,(H,26,27)/b14-13+,23-20- |
| InChIKey | WODGVUOGXQYVDD-ORQXDUDQSA-N |
| XLogP | 4.06 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|