C17H21N3O3S — CID 51092268
(E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2-methylsulfonylethyl)prop-2-enamide (PubChem CID 51092268) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2-methylsulfonylethyl)prop-2-enamide.
| Compound Name | (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2-methylsulfonylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 51092268 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-(2-methylsulfonylethyl)prop-2-enamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=C/C(=O)NCCS(C)(=O)=O |
| InChI | InChI=1S/C17H21N3O3S/c1-13-16(9-10-17(21)18-11-12-24(3,22)23)14(2)20(19-13)15-7-5-4-6-8-15/h4-10H,11-12H2,1-3H3,(H,18,21)/b10-9+ |
| InChIKey | OKSTUHZXTMUFCE-MDZDMXLPSA-N |
| XLogP | 1.66 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|