C19H18N2OS — CID 19555048
(E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1-(5-methylthiophen-2-yl)prop-2-en-1-one (PubChem CID 19555048) has the molecular formula C19H18N2OS and a molecular weight of 322.43 g/mol. Its IUPAC name is (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1-(5-methylthiophen-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1-(5-methylthiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19555048 |
| Molecular Formula | C19H18N2OS |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | (E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1-(5-methylthiophen-2-yl)prop-2-en-1-one |
| SMILES | Cc1ccc(C(=O)/C=C/c2c(C)nn(-c3ccccc3)c2C)s1 |
| InChI | InChI=1S/C19H18N2OS/c1-13-9-12-19(23-13)18(22)11-10-17-14(2)20-21(15(17)3)16-7-5-4-6-8-16/h4-12H,1-3H3/b11-10+ |
| InChIKey | LKZSSOBZWVXECH-ZHACJKMWSA-N |
| XLogP | 4.76 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|