C24H26N4O2 — CID 43071501
1-[4-[(E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoyl]phenyl]-3-propan-2-ylurea (PubChem CID 43071501) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 1-[4-[(E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoyl]phenyl]-3-propan-2-ylurea.
| Compound Name | 1-[4-[(E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoyl]phenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 43071501 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 1-[4-[(E)-3-(3,5-dimethyl-1-phenylpyrazol-4-yl)prop-2-enoyl]phenyl]-3-propan-2-ylurea |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=C/C(=O)c1ccc(NC(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C24H26N4O2/c1-16(2)25-24(30)26-20-12-10-19(11-13-20)23(29)15-14-22-17(3)27-28(18(22)4)21-8-6-5-7-9-21/h5-16H,1-4H3,(H2,25,26,30)/b15-14+ |
| InChIKey | VYVXSFAPQQYHCH-CCEZHUSRSA-N |
| XLogP | 4.92 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|