C19H15ClN2O — CID 6048412
(E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-1-phenylprop-2-en-1-one (PubChem CID 6048412) has the molecular formula C19H15ClN2O and a molecular weight of 322.80 g/mol. Its IUPAC name is (E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-1-phenylprop-2-en-1-one.
| Compound Name | (E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 6048412 |
| Molecular Formula | C19H15ClN2O |
| Molecular Weight | 322.80 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | (E)-3-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)-1-phenylprop-2-en-1-one |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1/C=C/C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H15ClN2O/c1-14-17(12-13-18(23)15-8-4-2-5-9-15)19(20)22(21-14)16-10-6-3-7-11-16/h2-13H,1H3/b13-12+ |
| InChIKey | UUIBLEFZMRHXHR-OUKQBFOZSA-N |
| XLogP | 4.73 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.80 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|