C22H18ClFN2O4 — CID 76877744
methyl 2-[4-[3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoyl]phenoxy]acetate (PubChem CID 76877744) has the molecular formula C22H18ClFN2O4 and a molecular weight of 428.85 g/mol. Its IUPAC name is methyl 2-[4-[3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 76877744 |
| Molecular Formula | C22H18ClFN2O4 |
| Molecular Weight | 428.85 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | methyl 2-[4-[3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(C(=O)C=Cc2c(C)nn(-c3ccc(F)cc3)c2Cl)cc1 |
| InChI | InChI=1S/C22H18ClFN2O4/c1-14-19(22(23)26(25-14)17-7-5-16(24)6-8-17)11-12-20(27)15-3-9-18(10-4-15)30-13-21(28)29-2/h3-12H,13H2,1-2H3 |
| InChIKey | WVBKQZUCEPEQSV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.85 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|