C19H21ClFN3O3 — CID 2492139
[2-(tert-butylamino)-2-oxoethyl] (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate (PubChem CID 2492139) has the molecular formula C19H21ClFN3O3 and a molecular weight of 393.85 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 2492139 |
| Molecular Formula | C19H21ClFN3O3 |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(Cl)c1/C=C/C(=O)OCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C19H21ClFN3O3/c1-12-15(9-10-17(26)27-11-16(25)22-19(2,3)4)18(20)24(23-12)14-7-5-13(21)6-8-14/h5-10H,11H2,1-4H3,(H,22,25)/b10-9+ |
| InChIKey | XASKCLSTOJFPTL-MDZDMXLPSA-N |
| XLogP | 3.44 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|