C26H29ClFN3O3 — CID 6216508
[2-(1-adamantylmethylamino)-2-oxoethyl] (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate (PubChem CID 6216508) has the molecular formula C26H29ClFN3O3 and a molecular weight of 485.99 g/mol. Its IUPAC name is [2-(1-adamantylmethylamino)-2-oxoethyl] (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-(1-adamantylmethylamino)-2-oxoethyl] (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 6216508 |
| Molecular Formula | C26H29ClFN3O3 |
| Molecular Weight | 485.99 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | [2-(1-adamantylmethylamino)-2-oxoethyl] (E)-3-[5-chloro-1-(4-fluorophenyl)-3-methylpyrazol-4-yl]prop-2-enoate |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(Cl)c1/C=C/C(=O)OCC(=O)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C26H29ClFN3O3/c1-16-22(25(27)31(30-16)21-4-2-20(28)3-5-21)6-7-24(33)34-14-23(32)29-15-26-11-17-8-18(12-26)10-19(9-17)13-26/h2-7,17-19H,8-15H2,1H3,(H,29,32)/b7-6+ |
| InChIKey | CQVPAYGYOSYZFR-VOTSOKGWSA-N |
| XLogP | 4.86 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.99 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|