C22H25ClFN3O — CID 8923689
N-(1-adamantylmethyl)-5-chloro-1-(4-fluorophenyl)-3-methylpyrazole-4-carboxamide (PubChem CID 8923689) has the molecular formula C22H25ClFN3O and a molecular weight of 401.91 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-5-chloro-1-(4-fluorophenyl)-3-methylpyrazole-4-carboxamide.
| Compound Name | N-(1-adamantylmethyl)-5-chloro-1-(4-fluorophenyl)-3-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 8923689 |
| Molecular Formula | C22H25ClFN3O |
| Molecular Weight | 401.91 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | N-(1-adamantylmethyl)-5-chloro-1-(4-fluorophenyl)-3-methylpyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(Cl)c1C(=O)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H25ClFN3O/c1-13-19(20(23)27(26-13)18-4-2-17(24)3-5-18)21(28)25-12-22-9-14-6-15(10-22)8-16(7-14)11-22/h2-5,14-16H,6-12H2,1H3,(H,25,28) |
| InChIKey | YABZLYVTIFDQGC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.91 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |