C16H17ClFN3O2 — CID 30823116
5-chloro-1-(4-fluorophenyl)-3-methyl-N-[[(2S)-oxolan-2-yl]methyl]pyrazole-4-carboxamide (PubChem CID 30823116) has the molecular formula C16H17ClFN3O2 and a molecular weight of 337.78 g/mol. Its IUPAC name is 5-chloro-1-(4-fluorophenyl)-3-methyl-N-[[(2S)-oxolan-2-yl]methyl]pyrazole-4-carboxamide.
| Compound Name | 5-chloro-1-(4-fluorophenyl)-3-methyl-N-[[(2S)-oxolan-2-yl]methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 30823116 |
| Molecular Formula | C16H17ClFN3O2 |
| Molecular Weight | 337.78 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 5-chloro-1-(4-fluorophenyl)-3-methyl-N-[[(2S)-oxolan-2-yl]methyl]pyrazole-4-carboxamide |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(Cl)c1C(=O)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C16H17ClFN3O2/c1-10-14(16(22)19-9-13-3-2-8-23-13)15(17)21(20-10)12-6-4-11(18)5-7-12/h4-7,13H,2-3,8-9H2,1H3,(H,19,22)/t13-/m0/s1 |
| InChIKey | JPMUIENXRSMASM-ZDUSSCGKSA-N |
| XLogP | 2.88 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.78 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |