C18H21N3O3 — CID 18160313
2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxo-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 18160313) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxo-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxo-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 18160313 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxo-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C18H21N3O3/c1-12-16(13(2)21(20-12)14-7-4-3-5-8-14)17(22)18(23)19-11-15-9-6-10-24-15/h3-5,7-8,15H,6,9-11H2,1-2H3,(H,19,23) |
| InChIKey | SEJOQURYNGSJGC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|