C25H29N5O2 — CID 46410529
2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxo-N-[2-(4-phenylpiperazin-1-yl)ethyl]acetamide (PubChem CID 46410529) has the molecular formula C25H29N5O2 and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxo-N-[2-(4-phenylpiperazin-1-yl)ethyl]acetamide.
| Compound Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxo-N-[2-(4-phenylpiperazin-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 46410529 |
| Molecular Formula | C25H29N5O2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxo-N-[2-(4-phenylpiperazin-1-yl)ethyl]acetamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(=O)C(=O)NCCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H29N5O2/c1-19-23(20(2)30(27-19)22-11-7-4-8-12-22)24(31)25(32)26-13-14-28-15-17-29(18-16-28)21-9-5-3-6-10-21/h3-12H,13-18H2,1-2H3,(H,26,32) |
| InChIKey | ACQHHXBYZPWYLH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|