C24H34N4O3 — CID 30710069
2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[(2S)-3-ethyl-2-morpholin-4-ylpentyl]-2-oxoacetamide (PubChem CID 30710069) has the molecular formula C24H34N4O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[(2S)-3-ethyl-2-morpholin-4-ylpentyl]-2-oxoacetamide.
| Compound Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[(2S)-3-ethyl-2-morpholin-4-ylpentyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 30710069 |
| Molecular Formula | C24H34N4O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[(2S)-3-ethyl-2-morpholin-4-ylpentyl]-2-oxoacetamide |
| SMILES | CCC(CC)[C@@H](CNC(=O)C(=O)c1c(C)nn(-c2ccccc2)c1C)N1CCOCC1 |
| InChI | InChI=1S/C24H34N4O3/c1-5-19(6-2)21(27-12-14-31-15-13-27)16-25-24(30)23(29)22-17(3)26-28(18(22)4)20-10-8-7-9-11-20/h7-11,19,21H,5-6,12-16H2,1-4H3,(H,25,30)/t21-/m1/s1 |
| InChIKey | KRDJYVKZIRGDHA-OAQYLSRUSA-N |
| XLogP | 2.93 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|