C22H33N5O3 — CID 55651605
N-(3-ethyl-2-morpholin-4-ylpentyl)-1-(3-methoxyphenyl)-5-methyltriazole-4-carboxamide (PubChem CID 55651605) has the molecular formula C22H33N5O3 and a molecular weight of 415.54 g/mol. Its IUPAC name is N-(3-ethyl-2-morpholin-4-ylpentyl)-1-(3-methoxyphenyl)-5-methyltriazole-4-carboxamide.
| Compound Name | N-(3-ethyl-2-morpholin-4-ylpentyl)-1-(3-methoxyphenyl)-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 55651605 |
| Molecular Formula | C22H33N5O3 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | N-(3-ethyl-2-morpholin-4-ylpentyl)-1-(3-methoxyphenyl)-5-methyltriazole-4-carboxamide |
| SMILES | CCC(CC)C(CNC(=O)c1nnn(-c2cccc(OC)c2)c1C)N1CCOCC1 |
| InChI | InChI=1S/C22H33N5O3/c1-5-17(6-2)20(26-10-12-30-13-11-26)15-23-22(28)21-16(3)27(25-24-21)18-8-7-9-19(14-18)29-4/h7-9,14,17,20H,5-6,10-13,15H2,1-4H3,(H,23,28) |
| InChIKey | LBOYMVXHCHJKRG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |