C23H33N3O3 — CID 55910695
1-(3-methoxyphenyl)-2,5-dimethyl-N-(3-methyl-2-morpholin-4-ylbutyl)pyrrole-3-carboxamide (PubChem CID 55910695) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2,5-dimethyl-N-(3-methyl-2-morpholin-4-ylbutyl)pyrrole-3-carboxamide.
| Compound Name | 1-(3-methoxyphenyl)-2,5-dimethyl-N-(3-methyl-2-morpholin-4-ylbutyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55910695 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | 1-(3-methoxyphenyl)-2,5-dimethyl-N-(3-methyl-2-morpholin-4-ylbutyl)pyrrole-3-carboxamide |
| SMILES | COc1cccc(-n2c(C)cc(C(=O)NCC(C(C)C)N3CCOCC3)c2C)c1 |
| InChI | InChI=1S/C23H33N3O3/c1-16(2)22(25-9-11-29-12-10-25)15-24-23(27)21-13-17(3)26(18(21)4)19-7-6-8-20(14-19)28-5/h6-8,13-14,16,22H,9-12,15H2,1-5H3,(H,24,27) |
| InChIKey | XJQKOKHKEBNYIK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|