C24H27N3O4S — CID 55972659
N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-(3-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxamide (PubChem CID 55972659) has the molecular formula C24H27N3O4S and a molecular weight of 453.56 g/mol. Its IUPAC name is N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-(3-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxamide.
| Compound Name | N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-(3-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55972659 |
| Molecular Formula | C24H27N3O4S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | N-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-(3-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxamide |
| SMILES | COc1cccc(-n2c(C)cc(C(=O)NCc3ccc(S(=O)(=O)NC4CC4)cc3)c2C)c1 |
| InChI | InChI=1S/C24H27N3O4S/c1-16-13-23(17(2)27(16)20-5-4-6-21(14-20)31-3)24(28)25-15-18-7-11-22(12-8-18)32(29,30)26-19-9-10-19/h4-8,11-14,19,26H,9-10,15H2,1-3H3,(H,25,28) |
| InChIKey | KBZWBATXPCMPGP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|