C21H21FN2O2 — CID 46532183
1-(2-fluorophenyl)-N-[(3-methoxyphenyl)methyl]-2,5-dimethylpyrrole-3-carboxamide (PubChem CID 46532183) has the molecular formula C21H21FN2O2 and a molecular weight of 352.41 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-[(3-methoxyphenyl)methyl]-2,5-dimethylpyrrole-3-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-N-[(3-methoxyphenyl)methyl]-2,5-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 46532183 |
| Molecular Formula | C21H21FN2O2 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 1-(2-fluorophenyl)-N-[(3-methoxyphenyl)methyl]-2,5-dimethylpyrrole-3-carboxamide |
| SMILES | COc1cccc(CNC(=O)c2cc(C)n(-c3ccccc3F)c2C)c1 |
| InChI | InChI=1S/C21H21FN2O2/c1-14-11-18(15(2)24(14)20-10-5-4-9-19(20)22)21(25)23-13-16-7-6-8-17(12-16)26-3/h4-12H,13H2,1-3H3,(H,23,25) |
| InChIKey | XHRLIEUVOVCHJZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|