C19H17NO3 — CID 27231686
3-hydroxy-N-[(3-methoxyphenyl)methyl]naphthalene-2-carboxamide (PubChem CID 27231686) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 3-hydroxy-N-[(3-methoxyphenyl)methyl]naphthalene-2-carboxamide.
| Compound Name | 3-hydroxy-N-[(3-methoxyphenyl)methyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 27231686 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 3-hydroxy-N-[(3-methoxyphenyl)methyl]naphthalene-2-carboxamide |
| SMILES | COc1cccc(CNC(=O)c2cc3ccccc3cc2O)c1 |
| InChI | InChI=1S/C19H17NO3/c1-23-16-8-4-5-13(9-16)12-20-19(22)17-10-14-6-2-3-7-15(14)11-18(17)21/h2-11,21H,12H2,1H3,(H,20,22) |
| InChIKey | TXMIJWCHPOMKHK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |