C15H13Br2NO2 — CID 103882071
2,4-dibromo-N-[(3-methoxyphenyl)methyl]benzamide (PubChem CID 103882071) has the molecular formula C15H13Br2NO2 and a molecular weight of 399.08 g/mol. Its IUPAC name is 2,4-dibromo-N-[(3-methoxyphenyl)methyl]benzamide.
| Compound Name | 2,4-dibromo-N-[(3-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 103882071 |
| Molecular Formula | C15H13Br2NO2 |
| Molecular Weight | 399.08 g/mol |
| Exact Mass | 396.93 |
| IUPAC Name | 2,4-dibromo-N-[(3-methoxyphenyl)methyl]benzamide |
| SMILES | COc1cccc(CNC(=O)c2ccc(Br)cc2Br)c1 |
| InChI | InChI=1S/C15H13Br2NO2/c1-20-12-4-2-3-10(7-12)9-18-15(19)13-6-5-11(16)8-14(13)17/h2-8H,9H2,1H3,(H,18,19) |
| InChIKey | HHWAKEAAIUHGPU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.08 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |