C14H10Br3NO — CID 107939159
2,4-dibromo-N-[(3-bromophenyl)methyl]benzamide (PubChem CID 107939159) has the molecular formula C14H10Br3NO and a molecular weight of 447.95 g/mol. Its IUPAC name is 2,4-dibromo-N-[(3-bromophenyl)methyl]benzamide.
| Compound Name | 2,4-dibromo-N-[(3-bromophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 107939159 |
| Molecular Formula | C14H10Br3NO |
| Molecular Weight | 447.95 g/mol |
| Exact Mass | 444.83 |
| IUPAC Name | 2,4-dibromo-N-[(3-bromophenyl)methyl]benzamide |
| SMILES | O=C(NCc1cccc(Br)c1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H10Br3NO/c15-10-3-1-2-9(6-10)8-18-14(19)12-5-4-11(16)7-13(12)17/h1-7H,8H2,(H,18,19) |
| InChIKey | JZJATMJTYUSMPP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.95 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |