C26H30FN3O2 — CID 55991329
1-(2-fluorophenyl)-N-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-2,5-dimethylpyrrole-3-carboxamide (PubChem CID 55991329) has the molecular formula C26H30FN3O2 and a molecular weight of 435.54 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-2,5-dimethylpyrrole-3-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-N-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-2,5-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55991329 |
| Molecular Formula | C26H30FN3O2 |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 1-(2-fluorophenyl)-N-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-2,5-dimethylpyrrole-3-carboxamide |
| SMILES | COc1cccc(CN2CCC(NC(=O)c3cc(C)n(-c4ccccc4F)c3C)CC2)c1 |
| InChI | InChI=1S/C26H30FN3O2/c1-18-15-23(19(2)30(18)25-10-5-4-9-24(25)27)26(31)28-21-11-13-29(14-12-21)17-20-7-6-8-22(16-20)32-3/h4-10,15-16,21H,11-14,17H2,1-3H3,(H,28,31) |
| InChIKey | UNLDPMVXKKABNX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|