C24H27FN4O — CID 86964132
1-(2-fluorophenyl)-2,5-dimethyl-N-[1-(6-methyl-2-pyridinyl)piperidin-4-yl]pyrrole-3-carboxamide (PubChem CID 86964132) has the molecular formula C24H27FN4O and a molecular weight of 406.51 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-2,5-dimethyl-N-[1-(6-methyl-2-pyridinyl)piperidin-4-yl]pyrrole-3-carboxamide.
| Compound Name | 1-(2-fluorophenyl)-2,5-dimethyl-N-[1-(6-methyl-2-pyridinyl)piperidin-4-yl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 86964132 |
| Molecular Formula | C24H27FN4O |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 1-(2-fluorophenyl)-2,5-dimethyl-N-[1-(6-methyl-2-pyridinyl)piperidin-4-yl]pyrrole-3-carboxamide |
| SMILES | Cc1cccc(N2CCC(NC(=O)c3cc(C)n(-c4ccccc4F)c3C)CC2)n1 |
| InChI | InChI=1S/C24H27FN4O/c1-16-7-6-10-23(26-16)28-13-11-19(12-14-28)27-24(30)20-15-17(2)29(18(20)3)22-9-5-4-8-21(22)25/h4-10,15,19H,11-14H2,1-3H3,(H,27,30) |
| InChIKey | FOAVUTNWFYUJQM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|