C24H26F2N4O — CID 55949930
N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxamide (PubChem CID 55949930) has the molecular formula C24H26F2N4O and a molecular weight of 424.50 g/mol. Its IUPAC name is N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxamide.
| Compound Name | N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55949930 |
| Molecular Formula | C24H26F2N4O |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | N-[1-[(3,4-difluorophenyl)methyl]piperidin-4-yl]-2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC2CCN(Cc3ccc(F)c(F)c3)CC2)c(C)n1-c1ccccn1 |
| InChI | InChI=1S/C24H26F2N4O/c1-16-13-20(17(2)30(16)23-5-3-4-10-27-23)24(31)28-19-8-11-29(12-9-19)15-18-6-7-21(25)22(26)14-18/h3-7,10,13-14,19H,8-9,11-12,15H2,1-2H3,(H,28,31) |
| InChIKey | OPEBCPOUVMPZTM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|