C26H33N5O — CID 55634446
N-[3-(4-benzylpiperazin-1-yl)propyl]-2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxamide (PubChem CID 55634446) has the molecular formula C26H33N5O and a molecular weight of 431.58 g/mol. Its IUPAC name is N-[3-(4-benzylpiperazin-1-yl)propyl]-2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxamide.
| Compound Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55634446 |
| Molecular Formula | C26H33N5O |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | N-[3-(4-benzylpiperazin-1-yl)propyl]-2,5-dimethyl-1-pyridin-2-ylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCN2CCN(Cc3ccccc3)CC2)c(C)n1-c1ccccn1 |
| InChI | InChI=1S/C26H33N5O/c1-21-19-24(22(2)31(21)25-11-6-7-12-27-25)26(32)28-13-8-14-29-15-17-30(18-16-29)20-23-9-4-3-5-10-23/h3-7,9-12,19H,8,13-18,20H2,1-2H3,(H,28,32) |
| InChIKey | KXZGFOCXWYAUOB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|