C26H30F3N5O — CID 55633991
2,5-dimethyl-1-pyridin-2-yl-N-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]pyrrole-3-carboxamide (PubChem CID 55633991) has the molecular formula C26H30F3N5O and a molecular weight of 485.55 g/mol. Its IUPAC name is 2,5-dimethyl-1-pyridin-2-yl-N-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]pyrrole-3-carboxamide.
| Compound Name | 2,5-dimethyl-1-pyridin-2-yl-N-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55633991 |
| Molecular Formula | C26H30F3N5O |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | 2,5-dimethyl-1-pyridin-2-yl-N-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCN2CCN(c3cccc(C(F)(F)F)c3)CC2)c(C)n1-c1ccccn1 |
| InChI | InChI=1S/C26H30F3N5O/c1-19-17-23(20(2)34(19)24-9-3-4-10-30-24)25(35)31-11-6-12-32-13-15-33(16-14-32)22-8-5-7-21(18-22)26(27,28)29/h3-5,7-10,17-18H,6,11-16H2,1-2H3,(H,31,35) |
| InChIKey | WEKNYDHXDPSGFB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|